Urolitino B milteliai

Lapkritis 9, 2020

„Cofttek“ yra geriausias Urolitino B miltelių gamintojas Kinijoje. Mūsų gamykla turi pilną gamybos valdymo sistemą (ISO9001 ir ISO14001), kurios mėnesinis gamybos pajėgumas yra 200 kg.

 


Statusas: Masinės gamybos
Vienetas: 1kg / maišas, 25kg / būgnas

Urolitinas BSpecifications

Vardas: Urolitinas B
Cheminis pavadinimas: 3-hidroksi-6H-dibenzo [b, d] piran-6-ono
CAS: 1139-83-9
Cheminė formulė: C13H8O3
Molekulinė masė: X
Spalva:  Balti milteliai
„InChi“ raktas: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kodas: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Pareigos: Urolitinas B gali pagerinti mitochondrijų ir raumenų funkcijas.

Urolitinas B gali pagerinti raumenų jėgą ir ištvermę senstant.

Naudojimas: Urolitinas B yra žarnyne esantis ellagitannio metabolitas ir pasižymi stipriu antioksidantų ir prooksidantų aktyvumu, priklausomai nuo tyrimo sistemos ir sąlygų. Urolitinas B taip pat gali rodyti estrogeninį ir (arba) antiestrogeninį poveikį.
Tirpumas: Lengvai tirpsta N, N-dimetilformamide ir dimetilmetilene. Sulfonas, mažai tirpus metanolyje, etanolyje ir etilo acetate
Laikymo temperatūra: Higroskopinis, -20 ° C šaldiklis, inertiška atmosfera
Pristatymo sąlyga: Pateikta aplinkos temperatūroje kaip nepavojinga cheminė medžiaga. Šis produktas yra pakankamai stabilus kelias savaites per įprastą gabenimą ir laiką, praleistą muitinėje.

 

Urolitinas B BMR spektras

Urolitinas B (1139-83-9) - BMR spektras

 

Jei jums reikia kiekvienos produkto partijos COA, MSDS, HNMR ir kitos informacijos, susisiekite su mumis marketingo vadybininkas.

 

Įvadas į urolitinus

Urolitinai yra antriniai elago rūgšties metabolitai, gauti iš ellagitaninų. Žmonėms žarnyno mikroflora elagitananinus paverčia ellago rūgštimi, kuri storosiose žarnose virsta urolitinais A, urolitinu B, urolitinu C ir urolitinu D.

Urolitinas A (UA) yra labiausiai paplitęs elagitaninų metabolitas. Tačiau nėra žinoma, kad urolitinas A natūraliai randamas jokiuose maisto šaltiniuose.

Urolitinas B (UB) yra gausus metabolitas, gaminamas žarnyne transformuojantis elagitananams. Urolitinas B yra paskutinis produktas po visų kitų urolitino darinių katabolizavimo. Urolitinas B yra šlapime kaip urolitinas B gliukuronidas.

Urolitinas A 8-metilo eteris yra tarpinis produktas sintezuojant urolitiną A. Tai yra reikšmingas antrinis elagitanino metabolitas ir pasižymi antioksidacinėmis ir priešuždegiminėmis savybėmis.

 

Urolitino A ir B veikimo mechanizmas

● Urolitinas A sukelia mitofagiją

Mitofagija yra viena iš autofagijos formų, padedančių pašalinti pažeistą mitochondriją, kad jos optimaliai funkcionuotų. Autofagija reiškia bendrą procesą, kurio metu citoplazmos turinys skaidomas ir atitinkamai perdirbamas, o mitofagija yra mitochondrijų skaidymas ir perdirbimas.

Senėjimo metu autofagijos sumažėjimas yra vienas aspektų, lemiantis mitochondrijų funkcijos sumažėjimą. Be to, oksidacinis stresas taip pat gali sukelti mažą autofagiją. Urolitinas A gali pašalinti pažeistas mitochondrijas per selektyvią autofagiją.

● Antioksidacinės savybės

Oksidacinis stresas atsiranda, kai organizme nėra pusiausvyros tarp laisvųjų radikalų ir antioksidantų. Šie laisvųjų radikalų perteklius dažnai yra susijęs su daugeliu lėtinių ligų, tokių kaip širdies sutrikimai, diabetas ir vėžys.

Urolitinai A ir B pasižymi antioksidaciniu poveikiu, nes gali sumažinti laisvųjų radikalų ir ypač ląstelių reaktyviųjų deguonies rūšių (ROS) kiekį, taip pat slopina lipidų peroksidaciją tam tikrų tipų ląstelėse.

Be to, urolitinai sugeba slopinti kai kuriuos oksiduojančius fermentus, įskaitant monoaminooksidazę A ir tirozinazę.

● Priešuždegiminės savybės

Uždegimas yra natūralus procesas, kurio metu mūsų kūnas kovoja su kritusiais daiktais, tokiais kaip infekcijos, traumos ir mikrobai. Tačiau lėtinis uždegimas gali būti kenksmingas organizmui, nes tai siejama su įvairiais sutrikimais, tokiais kaip astma, širdies problemos ir vėžys. Lėtinis uždegimas gali atsirasti dėl negydomo ūmaus uždegimo, infekcijų ar net laisvųjų radikalų organizme.

Urolitinai A ir B pasižymi priešuždegiminėmis savybėmis, slopindami azoto oksido gamybą. Jie ypač slopina indukuojamą azoto oksido sintazės (iNOS) baltymą ir mRNR raišką, kurie yra atsakingi už uždegimą.

● Antimikrobinis poveikis

Mikrobai, įskaitant bakterijas, grybelius ir virusus, natūraliai atsiranda aplinkoje ir net žmogaus kūne. Tačiau keli mikrobai, vadinami patogenais, gali sukelti infekcines ligas, tokias kaip gripas, tymai ir maliarija.

Urolitinas A ir B gali parodyti antimikrobinį poveikį slopindami kvorumo nustatymą. Kvorumo nustatymas yra bakterijų ryšio būdas, leidžiantis bakterijoms aptikti ir kontroliuoti su infekcija susijusius procesus, tokius kaip virulencija ir judrumas.

● Baltymų glikacijos slopinimas

Glikacija reiškia nefermentinį cukraus prisijungimą prie lipido ar baltymo. Tai pagrindinis diabeto ir kitų sutrikimų, taip pat senėjimo, biologinis žymeklis.

Didelė baltymų glikacija yra antrinis hiperglikemijos poveikis, turintis didelę reikšmę širdies ir kraujagyslių sistemos sutrikimams, tokiems kaip diabetas ir Alzheimerio liga.

Urolitinas A ir B pasižymi antiglikatinėmis savybėmis, kurios priklauso nuo dozės ir nepriklauso nuo jų antioksidacinio aktyvumo.

 

Urolitino B nauda

Urolitino B papildai taip pat turi keletą naudos sveikatai ir dauguma jų yra panašūs į urolitino A privalumus.

(1) Priešvėžinis potencialas
Dėl priešuždegiminių urolitino B savybių jis yra geras kandidatas kovojant su vėžiu. Kai kurie tyrėjai pranešė apie šį potencialą fibroblastų, mikrofagų ir endotelio ląstelėse.

Tyrimai pranešė, kad UB slopina įvairių rūšių vėžį, pavyzdžiui, prostatos, storosios žarnos ir šlapimo pūslės vėžį.

Tyrime, kuriame dalyvavo žmogaus storosios žarnos vėžio ląstelės, buvo įvertintas ellagitanninų, ellaginės rūgšties ir urolitinų A ir B priešvėžinis potencialas. Jie pranešė, kad visi gydymo būdai galėjo slopinti vėžio ląstelių augimą. Jie slopino vėžio ląstelių dauginimąsi, sustabdydami ląstelių ciklą skirtingose ​​fazėse, taip pat sukeldami apoptozę.

(2) Gali padėti kovoti su oksidaciniu stresu
Urolitinas B turi puikių antioksidacinių savybių, nes sumažina reaktyviųjų deguonies rūšių kiekį ir lipidų peroksidaciją tam tikruose ląstelių tipuose. Didelis ROS lygis yra susijęs su daugeliu sutrikimų, tokių kaip Alzheimerio liga.

Tyrimo metu, kuriame dalyvavo neuroninės ląstelės, veikiamos oksidacinio streso, nustatyta, kad urolitino B papildas, taip pat urolitinas A apsaugo ląsteles nuo oksidacijos, todėl padidėjo ląstelių išgyvenamumas.

(3) Urolitinas B atminties gerinimui
Pranešama, kad urolitinas b pagerina kraujo barjerų pralaidumą. Tai pagerina pažintinį funkcionavimą.

Tyrimai rodo, kad urolitinas B gali pagerinti potencialią atmintį, nes pagerina bendrą kognityvinį funkcionavimą.

(4) Apsaugo nuo raumenų praradimo
Raumenų praradimas gali atsirasti dėl įvairių priežasčių, tokių kaip sutrikimai, senėjimas ir baltymų trūkumas maiste. Gali būti naudojamos kelios priemonės raumenų netekimui sustabdyti, apriboti ar geriau užkirsti kelią, įskaitant mankštą, vaistus ir amino rūgštis, taip pat polifenolius.

Urolitinai gali būti klasifikuojami kaip polifenoliai ir vaidina svarbų vaidmenį užkertant kelią raumenų praradimui, suaktyvindami raumenų baltymų sintezę ir sulėtindami irimą.

Tyrimo su pelėmis metu buvo nustatyta, kad Urolithin B papildai, vartojami per tam tikrą laiką, pagerina jų raumenų vystymąsi, nes raumenys buvo matomi didesni.

(5) Urolitinas B kovoja su uždegimu
Urolitinas B pasižymi priešuždegiminėmis savybėmis, mažindamas daugumą uždegimo žymenų.

Tyrime su žiurkėmis, sergančiomis inkstų fibroze, nustatyta, kad urolitinas B palengvina inksto pažeidimą. Tai pagerino inkstų funkciją, inkstų morfologiją, taip pat sumažino inkstų pažeidimo žymenis. Tai rodo, kad UB sugebėjo sušvelninti inkstų uždegimą.

(6) Sinergetinė urolitino A ir B nauda
Sinergetinis poveikis taip pat buvo pastebėtas derinant urolitino A ir B kognityvinę funkciją ir gebėjimą. Tyrime teigiama, kad šis derinys gali būti naudojamas gydant ar užkertant kelią su demencija susijusiems sutrikimams, tokiems kaip nerimas ar Alzheimerio liga.

Kiti su urolitinais susiję privalumai yra;

  • neuroapsaugos
  • Pagerėja metabolinis sindromas

 

Urolitino A ir B maisto šaltiniai

Nežinoma, kad urolitinų natūraliai randama bet kuriuose maisto šaltiniuose. Jie yra ellaginių rūgščių, gaunamų iš ellagitanninų, virsmo produktas. Žarnyno mikrobiota ellagitanninus paverčia ellaginėmis rūgštimis, o storojoje žarnoje ellaginė rūgštis virsta metabolitais (urolitinais).

Ellagitaninai natūraliai randami maisto šaltiniuose, tokiuose kaip granatai, uogos, įskaitant braškes, avietes, debesynus ir gervuoges, muskadino vynuoges, migdolus, gvajavas, arbatą ir riešutus, tokius kaip graikiniai riešutai ir kaštainiai, taip pat ąžuolo sendintuose gėrimuose, pavyzdžiui, raudonajame vyne ir viskyje. ąžuolo statinės.

Todėl galime daryti išvadą, kad urolitino A maisto produktai ir urolitino B maisto produktai yra daug elagitanino turintys maisto produktai. Verta paminėti, kad elagitanino biologinis prieinamumas yra labai ribotas, o jo antriniai metabolitai (urolitinai) yra lengvai biologiškai prieinami.

Urolitinų išsiskyrimas ir gamyba labai skiriasi, nes virstant elagitaninais, žarnyne yra mikrobiota. Šioje konversijoje dalyvauja specifinės bakterijos, kurios gali skirtis tarp žmonių, kurių mikrobiota yra didelė, maža arba jos nėra. Maisto šaltiniai taip pat skiriasi savo elagitaninų lygiu. Taigi potenciali elagitaninų nauda kiekvienam žmogui skiriasi.

 

Urolitino A ir B papildai

Urolitino A papildai, taip pat urolitino B papildai yra lengvai randami rinkoje kaip maisto papildai, kuriuose gausu elagitanino. Urolitino A papildai taip pat yra lengvai prieinami. Daugiausia granatų papildai buvo plačiai parduodami ir sėkmingai naudojami. Šie papildai yra sintetinami iš vaisių ar riešutų ir suformuojami į skystą arba miltelių pavidalą.

Dėl skirtingo elagitaninų koncentracijos skirtinguose maisto produktuose urolitino pirkėjai jį perka atsižvelgdami į maisto šaltinį. Tas pats pasakytina ir apie urolitino B miltelių ar skystų papildų įsigijimą.

Keli klinikiniai žmogaus tyrimai, atlikti su urolitino A milteliais ar B, neparodė jokio rimto šalutinio poveikio, susijusio su šių papildų vartojimu.

Nuoroda

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). „Ellagitaninų metabolinis likimas: poveikis sveikatai ir novatoriškų funkcinių maisto produktų tyrimų perspektyvos“. Kritinės maisto mokslo ir mitybos apžvalgos.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 m. Lapkričio 2009 d.). „Urolitinai, žarnyno mikrobiniai granatų ellagitaninų metabolitai, pasižymi stipriu antioksidaciniu aktyvumu atliekant ląstelių tyrimą“. J Agric Food Chem.
  3. Bodvelas, Greimas; Pottie, Ian; Nandaluru, Penchal (2011). „Atvirkštinio elektronų poreikio Dielso-alksnio pagrindu atlikta bendra urolitino M7 sintezė“.