Urolitino B milteliai

Lapkritis 9, 2020

Urolitinas BSpecifications

Vardas: Urolitinas B
Cheminis pavadinimas: 3-hidroksi-6H-dibenzo [b, d] piran-6-ono
CAS: 1139-83-9
Cheminė formulė: C13H8O3
Molekulinė masė: X
Spalva:  Balti milteliai
„InChi“ raktas: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kodas: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Pareigos: Urolitinas B gali pagerinti mitochondrijų ir raumenų funkcijas.

Urolitinas B gali pagerinti raumenų jėgą ir ištvermę senstant.

Naudojimas: Urolitinas B yra žarnyne esantis ellagitannio metabolitas ir pasižymi stipriu antioksidantų ir prooksidantų aktyvumu, priklausomai nuo tyrimo sistemos ir sąlygų. Urolitinas B taip pat gali rodyti estrogeninį ir (arba) antiestrogeninį poveikį.
Tirpumas: Lengvai tirpsta N, N-dimetilformamide ir dimetilmetilene. Sulfonas, mažai tirpus metanolyje, etanolyje ir etilo acetate
Laikymo temperatūra: Higroskopinis, -20 ° C šaldiklis, inertiška atmosfera
Pristatymo sąlyga: Pateikta aplinkos temperatūroje kaip nepavojinga cheminė medžiaga. Šis produktas yra pakankamai stabilus kelias savaites per įprastą gabenimą ir laiką, praleistą muitinėje.

 

Urolitinas B BMR spektras

Urolitinas B (1139-83-9) - BMR spektras

 

Jei jums reikia kiekvienos produkto partijos COA, MSDS, HNMR ir kitos informacijos, susisiekite su mumis marketingo vadybininkas.